methyl 1-methyl-4-phenyl-4H-pyridine-3-carboxylate structure
|
Common Name | methyl 1-methyl-4-phenyl-4H-pyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 219786-85-3 | Molecular Weight | 229.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 1-methyl-4-phenyl-4H-pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H15NO2 |
|---|---|
| Molecular Weight | 229.27400 |
| Exact Mass | 229.11000 |
| PSA | 29.54000 |
| LogP | 2.22410 |
| InChIKey | UKKTVQVIAVVILG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN(C)C=CC1c1ccccc1 |
| HS Code | 2933399090 |
|---|
|
~99%
methyl 1-methyl... CAS#:219786-85-3 |
| Literature: Richter, Martin; Molnar, Josef; Hilgeroth, Andreas Journal of Medicinal Chemistry, 2006 , vol. 49, # 9 p. 2838 - 2840 |
|
~%
methyl 1-methyl... CAS#:219786-85-3 |
| Literature: Bennasar, M.-Lluisa; Juan, Cecilia; Bosch, Joan Tetrahedron Letters, 1998 , vol. 39, # 50 p. 9275 - 9278 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-METHYL-4-PHENYL-1,4-DIHYDRO-PYRIDINE-3-CARBOXYLIC ACID METHYL ESTER |
| 3-Pyridinecarboxylic acid,1,4-dihydro-1-methyl-4-phenyl-,methyl ester |
| methyl 1,4-dihydro-1-methyl-4-phenylpyridin-3-carboxylate |
| methyl 1,4-dihydro-1-methyl-4-phenylpyridine-3-carboxylate |
| Methyl 1-methyl-4-phenyl-1,4-dihydropyridine-3-carboxylate |