(r)-2-tert-butoxycarbonylamino-3-cyclopentyl-propionic acid structure
|
Common Name | (r)-2-tert-butoxycarbonylamino-3-cyclopentyl-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 219819-74-6 | Molecular Weight | 257.326 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 406.1±28.0 °C at 760 mmHg | |
| Molecular Formula | C13H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.4±24.0 °C | |
| Name | (2R)-3-cyclopentyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 406.1±28.0 °C at 760 mmHg |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.326 |
| Flash Point | 199.4±24.0 °C |
| Exact Mass | 257.162720 |
| PSA | 75.63000 |
| LogP | 3.13 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | GBTWGGHVJJRREA-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1CCCC1)C(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Cyclopentanepropanoic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]-, (αR)- |
| 3-Cyclopentyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-alanine |