N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide
Modify Date: 2026-08-15 15:28:34
![N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide Structure](https://www.chemsrc.com/extcaspic/457/2198564-25-7.png)
N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide structure
|
Common Name | N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 2198564-25-7 | Molecular Weight | 278.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H26N2O2 |
|---|---|
| Molecular Weight | 278.39 |
| InChIKey | RUQYXFKJZQZPIM-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NCCC(=O)N(C1CCC(C)CC1)C1CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide? |
| A: The English name of N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide is N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide. |
| Q: What is the CAS number of N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide? |
| A: CAS number of N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide is 2198564-25-7. |
| Q: What is the Chinese name of 2198564-25-7? |
| A: Chinese name of 2198564-25-7 is 2198564-25-7. |
| Q: What is the molecular weight of N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide? |
| A: Molecular weight of N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide is 278.39. |
| Q: What is the SMILES notation of N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide? |
| A: SMILES notation of N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide is C=CC(=O)NCCC(=O)N(C1CCC(C)CC1)C1CC1. |
| Q: What is the InChIKey of N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide? |
| A: InChIKey of N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide is RUQYXFKJZQZPIM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide? |
| A: Molecular formula of N-{2-[cyclopropyl(4-methylcyclohexyl)carbamoyl]ethyl}prop-2-enamide is C16H26N2O2. |