18-(Trimethylsilyloxy)-9-octadecenoic acid methyl ester structure
|
Common Name | 18-(Trimethylsilyloxy)-9-octadecenoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 21987-17-7 | Molecular Weight | 384.66800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H44O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 18-trimethylsilyloxyoctadec-9-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H44O3Si |
|---|---|
| Molecular Weight | 384.66800 |
| Exact Mass | 384.30600 |
| PSA | 35.53000 |
| LogP | 7.02850 |
| InChIKey | XNRDVMVIWVYCDP-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCCCCCC=CCCCCCCCCO[Si](C)(C)C |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 18-(Trimethylsilyloxy)-9-octadecenoic acid methyl ester |