9,10-Bis(trifluoroacetyloxy)octadecanoic acid methyl ester
Modify Date: 2025-10-04 17:22:37
9,10-Bis(trifluoroacetyloxy)octadecanoic acid methyl ester structure
|
Common Name | 9,10-Bis(trifluoroacetyloxy)octadecanoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 21987-19-9 | Molecular Weight | 522.51900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H36F6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 9,10-bis[(2,2,2-trifluoroacetyl)oxy]octadecanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H36F6O6 |
|---|---|
| Molecular Weight | 522.51900 |
| Exact Mass | 522.24200 |
| PSA | 78.90000 |
| LogP | 6.58890 |
| InChIKey | ABIVFLSDGLSYTC-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(OC(=O)C(F)(F)F)C(CCCCCCCC(=O)OC)OC(=O)C(F)(F)F |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 9,10-Bis(trifluoroacetyloxy)octadecanoic acid methyl ester |
| Octadecanoic acid,9,10-dihydroxy-,methyl ester,bis(trifluoroacetate) |
| Methyl 9,10-bis[(trifluoroacetyl)oxy]octadecanoate |