4-(TRIMETHYLSILYL)BENZALDEHYDE
4-(TRIMETHYLSILYL)BENZALDEHYDE structure
|
Common Name | 4-(TRIMETHYLSILYL)BENZALDEHYDE | ||
|---|---|---|---|---|
| CAS Number | 2199-32-8 | Molecular Weight | 178.30300 | |
| Density | 0.9960 g/cm3(Temp: 425 ℃) | Boiling Point | 119 ℃ at 760 mmHg | |
| Molecular Formula | C10H14OSi | Melting Point | 109-110 ℃ | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Trimethylsilylbenzaldehyde |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.9960 g/cm3(Temp: 425 ℃) |
|---|---|
| Boiling Point | 119 ℃ at 760 mmHg |
| Melting Point | 109-110 ℃ |
| Molecular Formula | C10H14OSi |
| Molecular Weight | 178.30300 |
| Exact Mass | 178.08100 |
| PSA | 17.07000 |
| LogP | 2.04430 |
| InChIKey | BPCNVZGALJUWSO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)c1ccc(C=O)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2931900090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-(trimethylsilyl)benzaldehyde |
| 4-trimethylsilanyl-benzaldehyde |
| me3Si(ph-4-CHO) |
| 4-(trimethylsilyl)benzaldehyde |
| Benzaldehyde,4-(trimethylsilyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-Trimethylsilylbenzaldehyde? |
| A: CAS number of 4-Trimethylsilylbenzaldehyde is 2199-32-8. |
| Q: What is the SMILES notation of 4-Trimethylsilylbenzaldehyde? |
| A: SMILES notation of 4-Trimethylsilylbenzaldehyde is C[Si](C)(C)c1ccc(C=O)cc1. |
| Q: What English synonyms does 4-Trimethylsilylbenzaldehyde have? |
| A: English synonyms of 4-Trimethylsilylbenzaldehyde: p-(trimethylsilyl)benzaldehyde, 4-trimethylsilanyl-benzaldehyde, me3Si(ph-4-CHO), 4-(trimethylsilyl)benzaldehyde, Benzaldehyde,4-(trimethylsilyl). |
| Q: What is the molecular weight of 4-Trimethylsilylbenzaldehyde? |
| A: Molecular weight of 4-Trimethylsilylbenzaldehyde is 178.30300. |
| Q: What is the boiling point of 4-Trimethylsilylbenzaldehyde? |
| A: Boiling point of 4-Trimethylsilylbenzaldehyde is 119 ℃ at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 4-Trimethylsilylbenzaldehyde? |
| A: Polar surface area (PSA) of 4-Trimethylsilylbenzaldehyde is 17.07000. |
| Q: What is the English name of 4-Trimethylsilylbenzaldehyde? |
| A: The English name of 4-Trimethylsilylbenzaldehyde is 4-Trimethylsilylbenzaldehyde. |
| Q: What is the InChIKey of 4-Trimethylsilylbenzaldehyde? |
| A: InChIKey of 4-Trimethylsilylbenzaldehyde is BPCNVZGALJUWSO-UHFFFAOYSA-N. |
| Q: What is the LogP of 4-Trimethylsilylbenzaldehyde? |
| A: LogP of 4-Trimethylsilylbenzaldehyde is 2.04430. |
| Q: What is the melting point of 4-Trimethylsilylbenzaldehyde? |
| A: Melting point of 4-Trimethylsilylbenzaldehyde is 109-110 ℃. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |