N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide
Modify Date: 2026-07-07 07:31:31
N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide structure
|
Common Name | N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide | ||
|---|---|---|---|---|
| CAS Number | 2199086-48-9 | Molecular Weight | 302.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H22N2O4S |
|---|---|
| Molecular Weight | 302.39 |
| InChIKey | OFKFOFHCZMKWNJ-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NCCC(=O)N1CCC(C)(C)S(=O)(=O)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide? |
| A: Molecular weight of N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide is 302.39. |
| Q: What is the molecular formula of N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide? |
| A: Molecular formula of N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide is C13H22N2O4S. |
| Q: What is the SMILES notation of N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide? |
| A: SMILES notation of N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide is C=CC(=O)NCCC(=O)N1CCC(C)(C)S(=O)(=O)CC1. |
| Q: What is the Chinese name of 2199086-48-9? |
| A: Chinese name of 2199086-48-9 is 2199086-48-9. |
| Q: What is the CAS number of N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide? |
| A: CAS number of N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide is 2199086-48-9. |
| Q: What is the English name of N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide? |
| A: The English name of N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide is N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide. |
| Q: What is the InChIKey of N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide? |
| A: InChIKey of N-(3-(7,7-Dimethyl-1,1-dioxido-1,4-thiazepan-4-yl)-3-oxopropyl)acrylamide is OFKFOFHCZMKWNJ-UHFFFAOYSA-N. |