(1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol
Modify Date: 2026-09-27 20:05:02
(1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol structure
|
Common Name | (1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol | ||
|---|---|---|---|---|
| CAS Number | 2199214-02-1 | Molecular Weight | 244.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H16N2O2 |
|---|---|
| Molecular Weight | 244.29 |
| InChIKey | PBNDDWOYJPUOBO-ZOBORPQBSA-N |
| SMILES | NC1c2ccc3ccccc3c2C(N)C(O)C1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol? |
| A: Molecular formula of (1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol is C14H16N2O2. |
| Q: What is the InChIKey of (1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol? |
| A: InChIKey of (1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol is PBNDDWOYJPUOBO-ZOBORPQBSA-N. |
| Q: What is the Chinese name of 2199214-02-1? |
| A: Chinese name of 2199214-02-1 is 2199214-02-1. |
| Q: What is the SMILES notation of (1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol? |
| A: SMILES notation of (1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol is NC1c2ccc3ccccc3c2C(N)C(O)C1O. |
| Q: What is the CAS number of (1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol? |
| A: CAS number of (1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol is 2199214-02-1. |
| Q: What is the molecular weight of (1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol? |
| A: Molecular weight of (1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol is 244.29. |
| Q: What is the English name of (1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol? |
| A: The English name of (1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol is (1R,2S,3R,4S)-1,4-diamino-1,2,3,4-tetrahydrophenanthrene-2,3-diol. |