1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate
Modify Date: 2025-09-09 23:18:23
1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate structure
|
Common Name | 1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate | ||
|---|---|---|---|---|
| CAS Number | 2199320-67-5 | Molecular Weight | 274.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H18O7 |
|---|---|
| Molecular Weight | 274.27 |
| InChIKey | KKKSODYZZKTXSX-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)OC(=O)CC(O)C(=O)OC(=O)C(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate? |
| A: Molecular weight of 1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate is 274.27. |
| Q: What is the InChIKey of 1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate? |
| A: InChIKey of 1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate is KKKSODYZZKTXSX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2199320-67-5? |
| A: Chinese name of 2199320-67-5 is 2199320-67-5. |
| Q: What is the CAS number of 1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate? |
| A: CAS number of 1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate is 2199320-67-5. |
| Q: What is the molecular formula of 1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate? |
| A: Molecular formula of 1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate is C12H18O7. |
| Q: What is the English name of 1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate? |
| A: The English name of 1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate is 1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate. |
| Q: What is the SMILES notation of 1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate? |
| A: SMILES notation of 1,4-Bis(2-methylpropanoyl) 2-hydroxybutanedioate is CC(C)C(=O)OC(=O)CC(O)C(=O)OC(=O)C(C)C. |