2-(2,2,2-trifluoroethyl)-2H,3H,5H,7H,8H-pyrano[4,3-c]pyridazin-3-one structure
|
Common Name | 2-(2,2,2-trifluoroethyl)-2H,3H,5H,7H,8H-pyrano[4,3-c]pyridazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 2199384-69-3 | Molecular Weight | 234.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2,2,2-trifluoroethyl)-2H,3H,5H,7H,8H-pyrano[4,3-c]pyridazin-3-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9F3N2O2 |
|---|---|
| Molecular Weight | 234.17 |
| InChIKey | RTRJRLLNENEHGO-UHFFFAOYSA-N |
| SMILES | O=c1cc2c(nn1CC(F)(F)F)CCOC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-(2,2,2-trifluoroethyl)-2H,3H,5H,7H,8H-pyrano[4,3-c]pyridazin-3-one? |
| A: SMILES notation of 2-(2,2,2-trifluoroethyl)-2H,3H,5H,7H,8H-pyrano[4,3-c]pyridazin-3-one is O=c1cc2c(nn1CC(F)(F)F)CCOC2. |
| Q: What is the CAS number of 2-(2,2,2-trifluoroethyl)-2H,3H,5H,7H,8H-pyrano[4,3-c]pyridazin-3-one? |
| A: CAS number of 2-(2,2,2-trifluoroethyl)-2H,3H,5H,7H,8H-pyrano[4,3-c]pyridazin-3-one is 2199384-69-3. |
| Q: What is the molecular weight of 2-(2,2,2-trifluoroethyl)-2H,3H,5H,7H,8H-pyrano[4,3-c]pyridazin-3-one? |
| A: Molecular weight of 2-(2,2,2-trifluoroethyl)-2H,3H,5H,7H,8H-pyrano[4,3-c]pyridazin-3-one is 234.17. |
| Q: What is the Chinese name of 2199384-69-3? |
| A: Chinese name of 2199384-69-3 is 2199384-69-3. |
| Q: What is the InChIKey of 2-(2,2,2-trifluoroethyl)-2H,3H,5H,7H,8H-pyrano[4,3-c]pyridazin-3-one? |
| A: InChIKey of 2-(2,2,2-trifluoroethyl)-2H,3H,5H,7H,8H-pyrano[4,3-c]pyridazin-3-one is RTRJRLLNENEHGO-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(2,2,2-trifluoroethyl)-2H,3H,5H,7H,8H-pyrano[4,3-c]pyridazin-3-one? |
| A: The English name of 2-(2,2,2-trifluoroethyl)-2H,3H,5H,7H,8H-pyrano[4,3-c]pyridazin-3-one is 2-(2,2,2-trifluoroethyl)-2H,3H,5H,7H,8H-pyrano[4,3-c]pyridazin-3-one. |
| Q: What is the molecular formula of 2-(2,2,2-trifluoroethyl)-2H,3H,5H,7H,8H-pyrano[4,3-c]pyridazin-3-one? |
| A: Molecular formula of 2-(2,2,2-trifluoroethyl)-2H,3H,5H,7H,8H-pyrano[4,3-c]pyridazin-3-one is C9H9F3N2O2. |