(3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic)
Modify Date: 2026-08-20 18:44:22
![(3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic) Structure](https://www.chemsrc.com/extcaspic/074/2199389-29-0.png)
(3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic) structure
|
Common Name | (3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic) | ||
|---|---|---|---|---|
| CAS Number | 2199389-29-0 | Molecular Weight | 242.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H18O2 |
|---|---|
| Molecular Weight | 242.31 |
| InChIKey | SFIWBVDCHNKANK-LSDHHAIUSA-N |
| SMILES | Cc1ccc(C2=CC3OC(C)(C)OC3C=C2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic)? |
| A: The English name of (3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic) is (3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic). |
| Q: What is the InChIKey of (3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic)? |
| A: InChIKey of (3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic) is SFIWBVDCHNKANK-LSDHHAIUSA-N. |
| Q: What is the molecular formula of (3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic)? |
| A: Molecular formula of (3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic) is C16H18O2. |
| Q: What is the Chinese name of 2199389-29-0? |
| A: Chinese name of 2199389-29-0 is 2199389-29-0. |
| Q: What is the SMILES notation of (3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic)? |
| A: SMILES notation of (3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic) is Cc1ccc(C2=CC3OC(C)(C)OC3C=C2)cc1. |
| Q: What is the molecular weight of (3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic)? |
| A: Molecular weight of (3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic) is 242.31. |
| Q: What is the CAS number of (3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic)? |
| A: CAS number of (3aR,7aS)-2,2-dimethyl-5-(p-tolyl)-3a,7a-dihydrobenzo[d][1,3]dioxole (racemic) is 2199389-29-0. |