(benzhydrylideneamino) N-methylcarbamate structure
|
Common Name | (benzhydrylideneamino) N-methylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 22001-32-7 | Molecular Weight | 254.28400 | |
| Density | 1.1g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (benzhydrylideneamino) N-methylcarbamate |
|---|
| Density | 1.1g/cm3 |
|---|---|
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.28400 |
| Exact Mass | 254.10600 |
| PSA | 50.69000 |
| LogP | 3.18590 |
| Index of Refraction | 1.565 |
| InChIKey | AFXCGMIVAMDFOR-UHFFFAOYSA-N |
| SMILES | CNC(=O)ON=C(c1ccccc1)c1ccccc1 |
|
~57%
(benzhydryliden... CAS#:22001-32-7 |
| Literature: Yoshida, Hiroshi; Ohtsuka, Hideki; Yoshida, Keisuke; Totani, Yoshiyuki; Ogata, Tsuyoshi; Matsumoto, Kiyoshi Bulletin of the Chemical Society of Japan, 1988 , vol. 61, # 12 p. 4347 - 4352 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |