O-Isopropyl Chlorthalidone
Modify Date: 2026-08-21 22:47:06
O-Isopropyl Chlorthalidone structure
|
Common Name | O-Isopropyl Chlorthalidone | ||
|---|---|---|---|---|
| CAS Number | 2200280-98-2 | Molecular Weight | 380.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17ClN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | O-Isopropyl Chlorthalidone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H17ClN2O4S |
|---|---|
| Molecular Weight | 380.8 |
| InChIKey | QCLXXCMKIVGGRG-UHFFFAOYSA-N |
| SMILES | CC(C)OC1(c2ccc(Cl)c(S(N)(=O)=O)c2)NC(=O)c2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of O-Isopropyl Chlorthalidone? |
| A: Molecular formula of O-Isopropyl Chlorthalidone is C17H17ClN2O4S. |
| Q: What is the CAS number of O-Isopropyl Chlorthalidone? |
| A: CAS number of O-Isopropyl Chlorthalidone is 2200280-98-2. |
| Q: What is the English name of O-Isopropyl Chlorthalidone? |
| A: The English name of O-Isopropyl Chlorthalidone is O-Isopropyl Chlorthalidone. |
| Q: What is the SMILES notation of O-Isopropyl Chlorthalidone? |
| A: SMILES notation of O-Isopropyl Chlorthalidone is CC(C)OC1(c2ccc(Cl)c(S(N)(=O)=O)c2)NC(=O)c2ccccc21. |
| Q: What is the molecular weight of O-Isopropyl Chlorthalidone? |
| A: Molecular weight of O-Isopropyl Chlorthalidone is 380.8. |
| Q: What is the InChIKey of O-Isopropyl Chlorthalidone? |
| A: InChIKey of O-Isopropyl Chlorthalidone is QCLXXCMKIVGGRG-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2200280-98-2? |
| A: Chinese name of 2200280-98-2 is 2200280-98-2. |