2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole
Modify Date: 2025-09-09 19:03:36
![2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole Structure](https://www.chemsrc.com/extcaspic/190/2200543-85-5.png)
2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole structure
|
Common Name | 2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole | ||
|---|---|---|---|---|
| CAS Number | 2200543-85-5 | Molecular Weight | 258.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H22N4 |
|---|---|
| Molecular Weight | 258.36 |
| InChIKey | PAEZXTRIXTWRLF-UHFFFAOYSA-N |
| SMILES | Cc1ncnc(N2CC3CN(C4CC4)CC3C2)c1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole? |
| A: SMILES notation of 2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole is Cc1ncnc(N2CC3CN(C4CC4)CC3C2)c1C. |
| Q: What is the English name of 2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole? |
| A: The English name of 2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole is 2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole. |
| Q: What is the molecular weight of 2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole? |
| A: Molecular weight of 2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole is 258.36. |
| Q: What is the CAS number of 2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole? |
| A: CAS number of 2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole is 2200543-85-5. |
| Q: What is the InChIKey of 2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole? |
| A: InChIKey of 2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole is PAEZXTRIXTWRLF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole? |
| A: Molecular formula of 2-Cyclopropyl-5-(5,6-dimethylpyrimidin-4-yl)octahydropyrrolo[3,4-c]pyrrole is C15H22N4. |
| Q: What is the Chinese name of 2200543-85-5? |
| A: Chinese name of 2200543-85-5 is 2200543-85-5. |