Cryptomerin B structure
|
Common Name | Cryptomerin B | ||
|---|---|---|---|---|
| CAS Number | 22012-98-2 | Molecular Weight | 566.51100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H22O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | cryptomerin B |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C32H22O10 |
|---|---|
| Molecular Weight | 566.51100 |
| Exact Mass | 566.12100 |
| PSA | 148.80000 |
| LogP | 6.15970 |
| InChIKey | XLXOFHHXAZAIHM-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)c(Oc4ccc(-c5cc(=O)c6c(O)cc(O)cc6o5)cc4)c(OC)cc3o2)cc1 |
|
Name: Inhibition of human amyloid beta (1 to 40) assessed as reduction in aggregation measu...
Source: ChEMBL
Target: Amyloid-beta precursor protein
External Id: CHEMBL4390040
|
| cryptomerin |
| 6-[4-(5,7-Dihydroxy-4-oxo-4H-chromen-2-yl)-phenoxy]-5-hydroxy-7-methoxy-2-(4-methoxy-phenyl)-chromen-4-one |
| 6-[4-(5,7-dihydroxy-4-oxo-4H-chromen-2-yl)-phenoxy]-5-hydroxy-7-methoxy-2-(4-methoxy-phenyl)-chromen-4-one |
| Cryptomerin B |