2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine
Modify Date: 2026-09-28 22:33:19
![2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine Structure](https://www.chemsrc.com/extcaspic/387/2201280-07-9.png)
2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine structure
|
Common Name | 2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine | ||
|---|---|---|---|---|
| CAS Number | 2201280-07-9 | Molecular Weight | 228.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14F2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14F2N2O |
|---|---|
| Molecular Weight | 228.24 |
| InChIKey | WKGYELDYNIHQIB-UHFFFAOYSA-N |
| SMILES | Cc1nccnc1OC1CCC(F)(F)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine? |
| A: Molecular formula of 2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine is C11H14F2N2O. |
| Q: What is the InChIKey of 2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine? |
| A: InChIKey of 2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine is WKGYELDYNIHQIB-UHFFFAOYSA-N. |
| Q: What is the English name of 2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine? |
| A: The English name of 2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine is 2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine. |
| Q: What is the Chinese name of 2201280-07-9? |
| A: Chinese name of 2201280-07-9 is 2201280-07-9. |
| Q: What is the molecular weight of 2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine? |
| A: Molecular weight of 2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine is 228.24. |
| Q: What is the SMILES notation of 2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine? |
| A: SMILES notation of 2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine is Cc1nccnc1OC1CCC(F)(F)CC1. |
| Q: What is the CAS number of 2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine? |
| A: CAS number of 2-[(4,4-Difluorocyclohexyl)oxy]-3-methylpyrazine is 2201280-07-9. |