Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester
Modify Date: 2025-09-03 17:58:19
![Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester Structure](https://www.chemsrc.com/extcaspic/292/22016-13-3.png)
Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester structure
|
Common Name | Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 22016-13-3 | Molecular Weight | 275.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H13Cl3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H13Cl3N2O2 |
|---|---|
| Molecular Weight | 275.6 |
| InChIKey | QEYVAUVDONGQRN-UHFFFAOYSA-N |
| SMILES | CCCCN=C(NC(=O)OC)C(Cl)(Cl)Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester? |
| A: The English name of Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester is Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester. |
| Q: What is the molecular formula of Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester? |
| A: Molecular formula of Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester is C8H13Cl3N2O2. |
| Q: What is the Chinese name of 22016-13-3? |
| A: Chinese name of 22016-13-3 is 22016-13-3. |
| Q: What is the molecular weight of Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester? |
| A: Molecular weight of Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester is 275.6. |
| Q: What is the CAS number of Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester? |
| A: CAS number of Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester is 22016-13-3. |
| Q: What is the InChIKey of Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester? |
| A: InChIKey of Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester is QEYVAUVDONGQRN-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester? |
| A: SMILES notation of Carbamic acid, [1-(butylamino)-2,2,2-trichloroethylidene]-, methyl ester is CCCCN=C(NC(=O)OC)C(Cl)(Cl)Cl. |