[benzoyl(phenylmethoxy)amino] 4-cyanobenzoate
Modify Date: 2026-08-19 18:15:43
![[benzoyl(phenylmethoxy)amino] 4-cyanobenzoate Structure](https://image.chemsrc.com/caspic/139/220168-52-5.png)
[benzoyl(phenylmethoxy)amino] 4-cyanobenzoate structure
|
Common Name | [benzoyl(phenylmethoxy)amino] 4-cyanobenzoate | ||
|---|---|---|---|---|
| CAS Number | 220168-52-5 | Molecular Weight | 372.37300 | |
| Density | 1.32g/cm3 | Boiling Point | 541.4ºC at 760mmHg | |
| Molecular Formula | C22H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.2ºC | |
| Name | [benzoyl(phenylmethoxy)amino] 4-cyanobenzoate |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 541.4ºC at 760mmHg |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.37300 |
| Flash Point | 281.2ºC |
| Exact Mass | 372.11100 |
| PSA | 79.63000 |
| LogP | 3.90428 |
| Vapour Pressure | 8.71E-12mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | RUXLDXUQVZKWOC-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C(=O)ON(OCc2ccccc2)C(=O)c2ccccc2)cc1 |
|
~%
[benzoyl(phenyl... CAS#:220168-52-5 |
| Literature: Glover, Stephen A.; Hammond, Gerard P.; Bonin, Antonio M. Journal of Organic Chemistry, 1998 , vol. 63, # 26 p. 9684 - 9689 |
|
~32%
[benzoyl(phenyl... CAS#:220168-52-5 |
| Literature: Glover, Stephen A.; Hammond, Gerard P.; Bonin, Antonio M. Journal of Organic Chemistry, 1998 , vol. 63, # 26 p. 9684 - 9689 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |