[benzoyl(phenylmethoxy)amino] 4-tert-butylbenzoate structure
|
Common Name | [benzoyl(phenylmethoxy)amino] 4-tert-butylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 220168-56-9 | Molecular Weight | 403.47000 | |
| Density | 1.172g/cm3 | Boiling Point | 517.7ºC at 760 mmHg | |
| Molecular Formula | C25H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.9ºC | |
| Name | [benzoyl(phenylmethoxy)amino] 4-tert-butylbenzoate |
|---|
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 517.7ºC at 760 mmHg |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.47000 |
| Flash Point | 266.9ºC |
| Exact Mass | 403.17800 |
| PSA | 55.84000 |
| LogP | 5.33010 |
| Vapour Pressure | 7.97E-11mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | CXRJSEQFRPDABN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)ON(OCc2ccccc2)C(=O)c2ccccc2)cc1 |
|
~%
[benzoyl(phenyl... CAS#:220168-56-9 |
| Literature: Glover, Stephen A.; Hammond, Gerard P.; Bonin, Antonio M. Journal of Organic Chemistry, 1998 , vol. 63, # 26 p. 9684 - 9689 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |