2-bromo-1-(4-methyl-3-nitrophenyl)ethanone structure
|
Common Name | 2-bromo-1-(4-methyl-3-nitrophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 22019-50-7 | Molecular Weight | 258.06900 | |
| Density | 1.59g/cm3 | Boiling Point | 305.3ºC at 760mmHg | |
| Molecular Formula | C9H8BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.4ºC | |
| Name | 2-bromo-1-(4-methyl-3-nitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 305.3ºC at 760mmHg |
| Molecular Formula | C9H8BrNO3 |
| Molecular Weight | 258.06900 |
| Flash Point | 138.4ºC |
| Exact Mass | 256.96900 |
| PSA | 62.89000 |
| LogP | 3.00400 |
| Vapour Pressure | 0.000829mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | DBMCVOBHUPAOMT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)CBr)cc1[N+](=O)[O-] |
| HS Code | 2914700090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3-Nitro-4-methyl-phenylacylbromid |
| 2-Bromo-1-(4-methyl-3-nitro-phenyl)-ethanone |
| 3-Nitro-4-methyl-phenacylbromid |
| 4-methyl-3-nitrophenacyl bromide |
| 2-bromo-1-(3-nitro-4-methylphenyl)ethanone |
| 2-Bromo-3-Nitro-4-Methylacetophenone |