(R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide
Modify Date: 2025-09-09 12:54:38
(R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide structure
|
Common Name | (R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide | ||
|---|---|---|---|---|
| CAS Number | 220263-58-1 | Molecular Weight | 189.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H19NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H19NOS |
|---|---|
| Molecular Weight | 189.32 |
| InChIKey | RDYKYUUGTHUYHS-GFCCVEGCSA-N |
| SMILES | CC(=NS(=O)C(C)(C)C)C(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide? |
| A: SMILES notation of (R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide is CC(=NS(=O)C(C)(C)C)C(C)C. |
| Q: What is the InChIKey of (R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide? |
| A: InChIKey of (R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide is RDYKYUUGTHUYHS-GFCCVEGCSA-N. |
| Q: What is the English name of (R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide? |
| A: The English name of (R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide is (R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide. |
| Q: What is the Chinese name of 220263-58-1? |
| A: Chinese name of 220263-58-1 is 220263-58-1. |
| Q: What is the CAS number of (R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide? |
| A: CAS number of (R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide is 220263-58-1. |
| Q: What is the molecular formula of (R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide? |
| A: Molecular formula of (R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide is C9H19NOS. |
| Q: What is the molecular weight of (R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide? |
| A: Molecular weight of (R,E)-2-methyl-N-(3-methylbutan-2-ylidene)propane-2-sulfinamide is 189.32. |