2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole
Modify Date: 2026-07-23 18:39:24
![2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole Structure](https://www.chemsrc.com/extcaspic/103/2202829-95-4.png)
2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole structure
|
Common Name | 2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole | ||
|---|---|---|---|---|
| CAS Number | 2202829-95-4 | Molecular Weight | 308.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7Cl2NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7Cl2NO2S2 |
|---|---|
| Molecular Weight | 308.2 |
| InChIKey | SIFWUEQNOZJUIW-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cc1cnc(Cl)s1)c1ccc(Cl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole? |
| A: SMILES notation of 2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole is O=S(=O)(Cc1cnc(Cl)s1)c1ccc(Cl)cc1. |
| Q: What is the CAS number of 2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole? |
| A: CAS number of 2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole is 2202829-95-4. |
| Q: What is the Chinese name of 2202829-95-4? |
| A: Chinese name of 2202829-95-4 is 2202829-95-4. |
| Q: What is the English name of 2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole? |
| A: The English name of 2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole is 2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole. |
| Q: What is the InChIKey of 2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole? |
| A: InChIKey of 2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole is SIFWUEQNOZJUIW-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole? |
| A: Molecular formula of 2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole is C10H7Cl2NO2S2. |
| Q: What is the molecular weight of 2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole? |
| A: Molecular weight of 2-Chloro-5-([(4-chlorophenyl)sulfonyl]-methyl)-1,3-thiazole is 308.2. |