Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt
Modify Date: 2025-09-08 19:09:45
![Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt Structure](https://www.chemsrc.com/extcaspic/191/2202948-77-2.png)
Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt structure
|
Common Name | Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt | ||
|---|---|---|---|---|
| CAS Number | 2202948-77-2 | Molecular Weight | 245.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H15NO6 |
|---|---|
| Molecular Weight | 245.23 |
| InChIKey | UNDQIGOLLPQSIF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C2CNCC21.O=C(O)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt? |
| A: CAS number of Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt is 2202948-77-2. |
| Q: What is the molecular formula of Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt? |
| A: Molecular formula of Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt is C10H15NO6. |
| Q: What is the SMILES notation of Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt? |
| A: SMILES notation of Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt is CCOC(=O)C1C2CNCC21.O=C(O)C(=O)O. |
| Q: What is the Chinese name of 2202948-77-2? |
| A: Chinese name of 2202948-77-2 is 2202948-77-2. |
| Q: What is the InChIKey of Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt? |
| A: InChIKey of Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt is UNDQIGOLLPQSIF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt? |
| A: Molecular weight of Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt is 245.23. |
| Q: What is the English name of Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt? |
| A: The English name of Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt is Ethyl 3-azabicyclo[3.1.0]hexane-6-carboxylate oxalate salt. |