Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate
Modify Date: 2026-08-29 11:53:10
Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate structure
|
Common Name | Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 220307-37-9 | Molecular Weight | 238.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14N2O4 |
|---|---|
| Molecular Weight | 238.24 |
| InChIKey | IIVNAWQNFWFPJG-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(N)c1ccc(C)c([N+](=O)[O-])c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate? |
| A: The English name of Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate is Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate. |
| Q: What is the molecular weight of Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate? |
| A: Molecular weight of Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate is 238.24. |
| Q: What is the InChIKey of Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate? |
| A: InChIKey of Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate is IIVNAWQNFWFPJG-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 220307-37-9? |
| A: Chinese name of 220307-37-9 is 220307-37-9. |
| Q: What is the SMILES notation of Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate? |
| A: SMILES notation of Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate is COC(=O)CC(N)c1ccc(C)c([N+](=O)[O-])c1. |
| Q: What is the molecular formula of Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate? |
| A: Molecular formula of Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate is C11H14N2O4. |
| Q: What is the CAS number of Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate? |
| A: CAS number of Methyl 3-amino-3-(4-methyl-3-nitrophenyl)propanoate is 220307-37-9. |