1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride
Modify Date: 2025-09-09 18:51:52
1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride structure
|
Common Name | 1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2203952-48-9 | Molecular Weight | 306.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H23Cl2F2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H23Cl2F2N3 |
|---|---|
| Molecular Weight | 306.22 |
| InChIKey | LGERPDBDVKGNMW-UHFFFAOYSA-N |
| SMILES | Cl.Cl.FC(F)CN1CCN(C2CCNCC2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2203952-48-9? |
| A: Chinese name of 2203952-48-9 is 2203952-48-9. |
| Q: What is the SMILES notation of 1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride? |
| A: SMILES notation of 1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride is Cl.Cl.FC(F)CN1CCN(C2CCNCC2)CC1. |
| Q: What is the English name of 1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride? |
| A: The English name of 1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride is 1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride. |
| Q: What is the molecular formula of 1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride? |
| A: Molecular formula of 1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride is C11H23Cl2F2N3. |
| Q: What is the molecular weight of 1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride? |
| A: Molecular weight of 1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride is 306.22. |
| Q: What is the CAS number of 1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride? |
| A: CAS number of 1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride is 2203952-48-9. |
| Q: What is the InChIKey of 1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride? |
| A: InChIKey of 1-(2,2-Difluoroethyl)-4-piperidin-4-yl-piperazine dihydrochloride is LGERPDBDVKGNMW-UHFFFAOYSA-N. |