1,3,4,5,6,6-hexamethylbicyclo[3.1.0]hex-3-en-2-one structure
|
Common Name | 1,3,4,5,6,6-hexamethylbicyclo[3.1.0]hex-3-en-2-one | ||
|---|---|---|---|---|
| CAS Number | 2206-69-1 | Molecular Weight | 178.27100 | |
| Density | 0.984g/cm3 | Boiling Point | 221ºC at 760 mmHg | |
| Molecular Formula | C12H18O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 94.2ºC | |
| Name | 1,3,4,5,6,6-hexamethylbicyclo[3.1.0]hex-3-en-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.984g/cm3 |
|---|---|
| Boiling Point | 221ºC at 760 mmHg |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27100 |
| Flash Point | 94.2ºC |
| Exact Mass | 178.13600 |
| PSA | 17.07000 |
| LogP | 2.95790 |
| Vapour Pressure | 0.11mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | SONHFFYISNVFJL-UHFFFAOYSA-N |
| SMILES | CC1=C(C)C2(C)C(C)(C)C2(C)C1=O |
| HS Code | 2914299000 |
|---|
|
~%
1,3,4,5,6,6-hex... CAS#:2206-69-1 |
| Literature: Hart,H. et al. Journal of the American Chemical Society, 1966 , vol. 88, p. 1005 - 1013 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2914299000 |
|---|---|
| Summary | 2914299000. other cyclanic, cyclenic or cyclotherpenic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Hexamethyl-bicyclo<3.1.0>hex-3-en-2-on |
| hexenon |