2-methyl-N-phenyliminopropane-2-sulfonamide structure
|
Common Name | 2-methyl-N-phenyliminopropane-2-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 22082-57-1 | Molecular Weight | 226.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-N-phenyliminopropane-2-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H14N2O2S |
|---|---|
| Molecular Weight | 226.29500 |
| Exact Mass | 226.07800 |
| PSA | 67.24000 |
| LogP | 3.97940 |
| InChIKey | ACZKDUQWFQZFBD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)S(=O)(=O)N=Nc1ccccc1 |
|
~%
2-methyl-N-phen... CAS#:22082-57-1 |
| Literature: Kobayashi, Michio; Gotoh, Michiko; Yoshida, Masato Bulletin of the Chemical Society of Japan, 1987 , vol. 60, # 1 p. 295 - 300 |
| t-butyl phenylazo sulfone |
| Benzoldiazo-2-methylpropan-2-sulfonat |