Phosphonic diamide, P-(b-hydroxyphenethyl)-N,N,N',N'-tetramethyl-(8CI) structure
|
Common Name | Phosphonic diamide, P-(b-hydroxyphenethyl)-N,N,N',N'-tetramethyl-(8CI) | ||
|---|---|---|---|---|
| CAS Number | 22084-53-3 | Molecular Weight | 256.28100 | |
| Density | 1.138g/cm3 | Boiling Point | 374.7ºC at 760mmHg | |
| Molecular Formula | C12H21N2O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.4ºC | |
| Name | (2-phenyl-2H-[1,2,3]triazol-4-yl)-methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 374.7ºC at 760mmHg |
| Molecular Formula | C12H21N2O2P |
| Molecular Weight | 256.28100 |
| Flash Point | 180.4ºC |
| Exact Mass | 256.13400 |
| PSA | 53.59000 |
| LogP | 2.03630 |
| Vapour Pressure | 2.79E-06mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | PLRAHBAENLQQDD-UHFFFAOYSA-N |
| SMILES | CN(C)P(=O)(CC(O)c1ccccc1)N(C)C |
|
~%
Phosphonic diam... CAS#:22084-53-3 |
| Literature: Corey,E.J.; Kwiatkowski,G.T. Journal of the American Chemical Society, 1968 , vol. 90, p. 6816 - 6821 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(2-phenyl-2H-1,2,3-triazole-4-yl)methanol |
| (2-Phenyl-2-hydroxy-aethan)-phosphonsaeure-bis-(dimethylamid) |