4'-methylsulfanyl-biphenyl-4-carbaldehyde structure
|
Common Name | 4'-methylsulfanyl-biphenyl-4-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 221018-02-6 | Molecular Weight | 228.30900 | |
| Density | 1.17g/cm3 | Boiling Point | 387.1ºC at 760 mmHg | |
| Molecular Formula | C14H12OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.9ºC | |
| Name | 4-(4-methylsulfanylphenyl)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 387.1ºC at 760 mmHg |
| Molecular Formula | C14H12OS |
| Molecular Weight | 228.30900 |
| Flash Point | 212.9ºC |
| Exact Mass | 228.06100 |
| PSA | 42.37000 |
| LogP | 3.88800 |
| Vapour Pressure | 3.38E-06mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | AIQQOUGEPPIVBV-UHFFFAOYSA-N |
| SMILES | CSc1ccc(-c2ccc(C=O)cc2)cc1 |
| HS Code | 2930909090 |
|---|
|
~92%
4'-methylsulfan... CAS#:221018-02-6 |
| Literature: Siamaki, Ali R.; Khder, Abd El Rahman S.; Abdelsayed, Victor; El-Shall, M. Samy; Gupton, B. Frank Journal of Catalysis, 2011 , vol. 279, # 1 p. 1 - 11 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4'-methylsulfanyl-biphenyl-4-carbaldehyde |
| MFCD04117401 |