FFN246 structure
|
Common Name | FFN246 | ||
|---|---|---|---|---|
| CAS Number | 2210244-83-8 | Molecular Weight | 292.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14ClFN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FFN246Novel fluorescent substrate for both the serotonin transporter and the vesicular monoamine transporter 2 (VMAT2) |
| Name | FFN246 |
|---|
| Description | Novel fluorescent substrate for both the serotonin transporter and the vesicular monoamine transporter 2 (VMAT2) |
|---|
| Molecular Formula | C15H14ClFN2O |
|---|---|
| Molecular Weight | 292.74 |
| InChIKey | SMTKPXKSQXDLCY-UHFFFAOYSA-N |
| SMILES | NCCc1ccc2[nH]c3cccc(F)c3c(=O)c2c1 |