Ethyl 4-(3-fluorophenyl)-3-oxobutanoate structure
|
Common Name | Ethyl 4-(3-fluorophenyl)-3-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 221121-36-4 | Molecular Weight | 224.228 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 289.4±20.0 °C at 760 mmHg | |
| Molecular Formula | C12H13FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.8±16.7 °C | |
| Name | ethyl 4-(3-fluorophenyl)-3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 289.4±20.0 °C at 760 mmHg |
| Molecular Formula | C12H13FO3 |
| Molecular Weight | 224.228 |
| Flash Point | 124.8±16.7 °C |
| Exact Mass | 224.084869 |
| PSA | 43.37000 |
| LogP | 2.50 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | WLQMLHGMFCBMLJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)Cc1cccc(F)c1 |
| HS Code | 2918300090 |
|---|
|
~%
Ethyl 4-(3-fluo... CAS#:221121-36-4 |
| Literature: Mai, Antonello; Artico, Marino; Sbardella, Gianluca; Massa, Silvio; Novellino, Ettore; Greco, Giovanni; Loi, Anna Giulia; Tramontane, Enzo; Marongiu, Maria Elena; La Colla, Paolo Journal of Medicinal Chemistry, 1999 , vol. 42, # 4 p. 619 - 627 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Ethyl 4-(3-fluorophenyl)-3-oxobutanoate |
| Benzenebutanoic acid, 3-fluoro-β-oxo-, ethyl ester |
| 4-(3-Fluoro-phenyl)-3-oxo-butyric acid ethyl ester |