(NZ)-N-(2-phenylchromen-4-ylidene)hydroxylamine structure
|
Common Name | (NZ)-N-(2-phenylchromen-4-ylidene)hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 22115-89-5 | Molecular Weight | 237.25300 | |
| Density | 1.2g/cm3 | Boiling Point | 404.4ºC at 760 mmHg | |
| Molecular Formula | C15H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.4ºC | |
| Name | (NE)-N-(2-phenylchromen-4-ylidene)hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 404.4ºC at 760 mmHg |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.25300 |
| Flash Point | 198.4ºC |
| Exact Mass | 237.07900 |
| PSA | 45.73000 |
| LogP | 3.38970 |
| Vapour Pressure | 2.88E-07mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | BCVRSZHAXBCUKF-DTQAZKPQSA-N |
| SMILES | ON=c1cc(-c2ccccc2)oc2ccccc12 |
|
~%
(NZ)-N-(2-pheny... CAS#:22115-89-5 |
| Literature: Baker et al. Journal of the Chemical Society, 1952 , p. 1294,1301 Journal of the Chemical Society, 1954 , p. 998,1000 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-phenyl-chromen-4-one oxime |
| 2-Phenyl-4H-benzopyran-4-on-oxim |
| 2-Phenyl-chromen-4-on-oxim |
| Flavon-oxim |