2-[(E)-2-(2-methylphenyl)ethenyl]-4,5-dihydro-1H-imidazole,oxalic acid structure
|
Common Name | 2-[(E)-2-(2-methylphenyl)ethenyl]-4,5-dihydro-1H-imidazole,oxalic acid | ||
|---|---|---|---|---|
| CAS Number | 221225-04-3 | Molecular Weight | 276.28800 | |
| Density | N/A | Boiling Point | 309.1ºC at 760 mmHg | |
| Molecular Formula | C14H16N2O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 140.7ºC | |
| Name | 2-[(E)-2-(2-methylphenyl)ethenyl]-4,5-dihydro-1H-imidazole,oxalic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 309.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.28800 |
| Flash Point | 140.7ºC |
| Exact Mass | 276.11100 |
| PSA | 98.99000 |
| LogP | 0.92990 |
| Vapour Pressure | 0.000655mmHg at 25°C |
| InChIKey | QDUUQIGHAAEJDO-UHDJGPCESA-N |
| SMILES | Cc1ccccc1C=CC1=NCCN1.O=C(O)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Hyperphagic effect of novel compounds with high affinity for imidazoline I(2) binding sites.
Eur. J. Pharmacol. 392 , 41-49, (2000) Previous studies have suggested that imidazoline I(2) receptors play a role in feeding control in rats. The effect of subcutaneous (s.c.) injections of four novel imidazoline I(2) ligands, 2-naphthale... |
| HMS2230J19 |
| HMS3262M18 |
| Metrazoline |
| 4,5-Dihydro-2-[(1E)-2-(2-methylphenyl)ethenyl-1H-imidazole oxalate salt |
| Metrazoline oxalate |