1,2-Benzenediol,5-methyl-3-(1,1,3,3-tetramethylbutyl)- structure
|
Common Name | 1,2-Benzenediol,5-methyl-3-(1,1,3,3-tetramethylbutyl)- | ||
|---|---|---|---|---|
| CAS Number | 2213-68-5 | Molecular Weight | 236.35000 | |
| Density | 1.004g/cm3 | Boiling Point | 333.8ºC at 760mmHg | |
| Molecular Formula | C15H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.7ºC | |
| Name | 5-methyl-3-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.004g/cm3 |
|---|---|
| Boiling Point | 333.8ºC at 760mmHg |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35000 |
| Flash Point | 147.7ºC |
| Exact Mass | 236.17800 |
| PSA | 40.46000 |
| LogP | 4.12000 |
| Vapour Pressure | 6.9E-05mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | KEUANYXDVWBCRM-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(O)c(C(C)(C)CC(C)(C)C)c1 |
| HS Code | 2907299090 |
|---|
|
~%
1,2-Benzenediol... CAS#:2213-68-5 |
| Literature: Pospisil,J.; Taimr,L. Collection of Czechoslovak Chemical Communications, 1965 , vol. 30, p. 1092 - 1103 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 5-Methyl-3-tert-octyl-brenzcatechin |
| 3-tert-Octyl-5-methyl-brenzcatechin |
| 6-Diisobutyl-4-methylpyrocatechol |