methyl 2-chloro-3,5-dinitrobenzoate structure
|
Common Name | methyl 2-chloro-3,5-dinitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 2213-79-8 | Molecular Weight | 260.58800 | |
| Density | 1.599g/cm3 | Boiling Point | 384.9ºC at 760mmHg | |
| Molecular Formula | C8H5ClN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.6ºC | |
| Name | methyl 2-chloro-3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.599g/cm3 |
|---|---|
| Boiling Point | 384.9ºC at 760mmHg |
| Molecular Formula | C8H5ClN2O6 |
| Molecular Weight | 260.58800 |
| Flash Point | 186.6ºC |
| Exact Mass | 259.98400 |
| PSA | 117.94000 |
| LogP | 2.98940 |
| Vapour Pressure | 3.95E-06mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | RJQRHZYXGHSNKQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1Cl |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Chlor-3,5-dinitro-benzoesaeure-methylester |
| methyl-2-chloro-3,5-dinitrobenzoate |
| methyl 2-chloro-3,5-dinitrobenzenecarboxylate |
| 2-chloro-3,5-dinitro-benzoic acid methyl ester |
| benzoic acid,2-chloro-3,5-dinitro-,methyl ester |