Benzene,2,5-dichloro-1,3-dinitro- structure
|
Common Name | Benzene,2,5-dichloro-1,3-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 2213-82-3 | Molecular Weight | 236.99700 | |
| Density | 1.729g/cm3 | Boiling Point | 315.8ºC at 760mmHg | |
| Molecular Formula | C6H2Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.8ºC | |
| Name | 2,5-dichloro-1,3-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.729g/cm3 |
|---|---|
| Boiling Point | 315.8ºC at 760mmHg |
| Molecular Formula | C6H2Cl2N2O4 |
| Molecular Weight | 236.99700 |
| Flash Point | 144.8ºC |
| Exact Mass | 235.93900 |
| PSA | 91.64000 |
| LogP | 3.85620 |
| Vapour Pressure | 0.000793mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | AGGUKALRPKAKSM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)cc([N+](=O)[O-])c1Cl |
| HS Code | 2904909090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,5-Dichlor-1,3-dinitro-benzol |
| AmbscLK-144 |
| 2,5-dichloro-1,3-dinitro-benzene |
| 1,3-dinitro-2,5-dichlorobenzene |
| 1,4-Dichloro-2,6-dinitrobenzene |
| 2,5-dichloro-1,5-dinitrobenzene |
| 2,3-dinitrobenzene |
| 2,6-Dinitro-1,4-dichlorobenzene |