Butalamine structure
|
Common Name | Butalamine | ||
|---|---|---|---|---|
| CAS Number | 22131-35-7 | Molecular Weight | 316.44 | |
| Density | 1.057g/cm3 | Boiling Point | 437.5ºC at 760mmHg | |
| Molecular Formula | C18H28N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.4ºC | |
Use of ButalamineButalamine is a vasodilator[1]. |
| Name | N',N'-dibutyl-N-(3-phenyl-1,2,4-oxadiazol-5-yl)ethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Description | Butalamine is a vasodilator[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.057g/cm3 |
|---|---|
| Boiling Point | 437.5ºC at 760mmHg |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.44 |
| Flash Point | 218.4ºC |
| Exact Mass | 316.22600 |
| PSA | 54.19000 |
| LogP | 4.12370 |
| Vapour Pressure | 7.43E-08mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | VYWQZAARVNRSTR-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)CCNc1nc(-c2ccccc2)no1 |
|
Name: Literature-mined public compounds from Kruhlak et al phospholipidosis modelling datas...
Source: ChEMBL
Target: Phospholipidosis
External Id: CHEMBL1697855
|
| dibutylimolamine |
| EINECS 244-794-9 |
| Butalamine |
| Butalaminum |
| Butalamina |