2-(2,2-Dimethyl-propionyloxymethyl)-thiazole-4-carboxylic acid structure
|
Common Name | 2-(2,2-Dimethyl-propionyloxymethyl)-thiazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 221322-07-2 | Molecular Weight | 243.28000 | |
| Density | 1.301 g/cm3 | Boiling Point | 380.791ºC at 760 mmHg | |
| Molecular Formula | C10H13NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,2-dimethylpropanoyloxymethyl)-1,3-thiazole-4-carboxylic acid |
|---|
| Density | 1.301 g/cm3 |
|---|---|
| Boiling Point | 380.791ºC at 760 mmHg |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28000 |
| Exact Mass | 243.05700 |
| PSA | 104.73000 |
| LogP | 1.93060 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | UFIUMDMAMPMTQG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OCc1nc(C(=O)O)cs1 |
| HS Code | 2934100090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |