Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide
Modify Date: 2025-09-01 16:12:17
![Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide Structure](https://www.chemsrc.com/extcaspic/144/2213402-76-5.png)
Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide structure
|
Common Name | Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide | ||
|---|---|---|---|---|
| CAS Number | 2213402-76-5 | Molecular Weight | 438.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22N4O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H22N4O2S2 |
|---|---|
| Molecular Weight | 438.6 |
| InChIKey | SHHYOZTXDYYSPT-UHFFFAOYSA-N |
| SMILES | CC(C)c1noc(-c2ccccc2SSc2ccccc2-c2nc(C(C)C)no2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide? |
| A: SMILES notation of Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide is CC(C)c1noc(-c2ccccc2SSc2ccccc2-c2nc(C(C)C)no2)n1. |
| Q: What is the Chinese name of 2213402-76-5? |
| A: Chinese name of 2213402-76-5 is 2213402-76-5. |
| Q: What is the molecular formula of Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide? |
| A: Molecular formula of Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide is C22H22N4O2S2. |
| Q: What is the molecular weight of Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide? |
| A: Molecular weight of Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide is 438.6. |
| Q: What is the English name of Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide? |
| A: The English name of Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide is Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide. |
| Q: What is the InChIKey of Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide? |
| A: InChIKey of Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide is SHHYOZTXDYYSPT-UHFFFAOYSA-N. |
| Q: What is the CAS number of Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide? |
| A: CAS number of Di[(3-Isopropyl-1,2,4-oxadiazol-5-yl)phen-2-yl]-disuflide is 2213402-76-5. |