Bicyclo[2.2.2]oct-2-ene-1-carbonyl chloride, 4-methyl- (8CI,9CI) structure
|
Common Name | Bicyclo[2.2.2]oct-2-ene-1-carbonyl chloride, 4-methyl- (8CI,9CI) | ||
|---|---|---|---|---|
| CAS Number | 22148-41-0 | Molecular Weight | 184.66300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methylbicyclo[2.2.2]oct-2-ene-4-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13ClO |
|---|---|
| Molecular Weight | 184.66300 |
| Exact Mass | 184.06500 |
| PSA | 17.07000 |
| LogP | 2.88830 |
| InChIKey | SOAAMNUFLNDWCO-UHFFFAOYSA-N |
| SMILES | CC12C=CC(C(=O)Cl)(CC1)CC2 |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| oct-2-en-1-carbonylchlorid |
| 4-Methylbicyclo<2.2.2>oct-2-en-1-carbonsaeurechlorid |