(E)-3-(4-Phenoxyphenyl)acrylic acid structure
|
Common Name | (E)-3-(4-Phenoxyphenyl)acrylic acid | ||
|---|---|---|---|---|
| CAS Number | 2215-83-0 | Molecular Weight | 240.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-phenoxyphenyl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12O3 |
|---|---|
| Molecular Weight | 240.25400 |
| Exact Mass | 240.07900 |
| PSA | 46.53000 |
| LogP | 3.57670 |
| InChIKey | XWGDODCEQXQAFQ-DHZHZOJOSA-N |
| SMILES | O=C(O)C=Cc1ccc(Oc2ccccc2)cc1 |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Phenoxy-trans-zimtsaeure |
| p-phenoxycinnamic acid |
| 4-phenoxy-trans-cinnamic acid |
| 4-phenoxycinnamic acid |