5-Chloro-2,4-thiophenedi(sulfonamide) structure
|
Common Name | 5-Chloro-2,4-thiophenedi(sulfonamide) | ||
|---|---|---|---|---|
| CAS Number | 22167-99-3 | Molecular Weight | 276.74200 | |
| Density | 1.86g/cm3 | Boiling Point | 584.3ºC at 760mmHg | |
| Molecular Formula | C4H5ClN2O4S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.2ºC | |
| Name | 5-chlorothiophene-2,4-disulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.86g/cm3 |
|---|---|
| Boiling Point | 584.3ºC at 760mmHg |
| Molecular Formula | C4H5ClN2O4S3 |
| Molecular Weight | 276.74200 |
| Flash Point | 307.2ºC |
| Exact Mass | 275.91000 |
| PSA | 165.32000 |
| LogP | 3.25850 |
| Vapour Pressure | 1.22E-13mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | MYGOAWSTBUIRKA-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cc(S(N)(=O)=O)c(Cl)s1 |
| HS Code | 2935009090 |
|---|
|
~%
5-Chloro-2,4-th... CAS#:22167-99-3 |
| Literature: de Stevens et al. Journal of Medicinal and Pharmaceutical Chemistry, 1959 , vol. 1, p. 565,573 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 2-Chlor-thiophen-3,5-disulfonamid |
| 5-Chloro-2,4-thiophenedisulfonamide |
| 2,4-Thiophenedisulfonamide,5-chloro |
| 5-chloro-thiophene-2,4-disulfonic acid diamide |
| 5-Chlor-thiophen-2,4-disulfonsaeure-diamid |