bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate
bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate structure
|
Common Name | bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 22173-24-6 | Molecular Weight | 286.40700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H30O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H30O4 |
|---|---|
| Molecular Weight | 286.40700 |
| Exact Mass | 286.21400 |
| PSA | 52.60000 |
| LogP | 4.01040 |
| InChIKey | TUQIRKHDYKGDJL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCCCC(=O)OC(C)(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:84109-76-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| octanedioic acid di-tert-butyl ester |
| Suberinsaeure-di-tert-butylester |
| Octandisaeure-di-tert-butylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 22173-24-6? |
| A: Chinese name of 22173-24-6 is 22173-24-6. |
| Q: What is the CAS number of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate? |
| A: CAS number of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate is 22173-24-6. |
| Q: What are the downstream products of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate? |
| A: Related downstream products(CAS) of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate: 84109-76-2. |
| Q: What is the LogP of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate? |
| A: LogP of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate is 4.01040. |
| Q: What is the SMILES notation of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate? |
| A: SMILES notation of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate is CC(C)(C)OC(=O)CCCCCCC(=O)OC(C)(C)C. |
| Q: What English synonyms does bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate have? |
| A: English synonyms of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate: octanedioic acid di-tert-butyl ester, Suberinsaeure-di-tert-butylester, Octandisaeure-di-tert-butylester. |
| Q: What is the polar surface area (PSA) of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate? |
| A: Polar surface area (PSA) of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate is 52.60000. |
| Q: What is the InChIKey of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate? |
| A: InChIKey of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate is TUQIRKHDYKGDJL-UHFFFAOYSA-N. |
| Q: What is the English name of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate? |
| A: The English name of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate is bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate. |
| Q: What is the molecular formula of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate? |
| A: Molecular formula of bis(1,1-dimethylethyl) 1,6-hexanedicarboxylate is C16H30O4. |