1-benzyl-1,2-dihydro-2-[(4-methoxyphenyl)methyl]-3,4-dimethylpyridine structure
|
Common Name | 1-benzyl-1,2-dihydro-2-[(4-methoxyphenyl)methyl]-3,4-dimethylpyridine | ||
|---|---|---|---|---|
| CAS Number | 22185-50-8 | Molecular Weight | 319.44000 | |
| Density | 1.062g/cm3 | Boiling Point | 469.9ºC at 760mmHg | |
| Molecular Formula | C22H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.7ºC | |
| Name | 1-benzyl-2-[(4-methoxyphenyl)methyl]-3,4-dimethyl-2H-pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.062g/cm3 |
|---|---|
| Boiling Point | 469.9ºC at 760mmHg |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.44000 |
| Flash Point | 136.7ºC |
| Exact Mass | 319.19400 |
| PSA | 12.47000 |
| LogP | 4.91010 |
| Vapour Pressure | 5.31E-09mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | KSKPCURZYVZTBP-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC2C(C)=C(C)C=CN2Cc2ccccc2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 244-825-6 |