rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate
Modify Date: 2026-07-21 20:02:45
![rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate Structure](https://www.chemsrc.com/extcaspic/055/2219360-82-2.png)
rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate structure
|
Common Name | rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate | ||
|---|---|---|---|---|
| CAS Number | 2219360-82-2 | Molecular Weight | 239.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H21NO3 |
|---|---|
| Molecular Weight | 239.31 |
| InChIKey | AAPZKZIDFCJVDH-ABMFXWLOSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CC2CC1C1OC21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate? |
| A: SMILES notation of rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate is CC(C)(C)OC(=O)NCC1CC2CC1C1OC21. |
| Q: What is the Chinese name of 2219360-82-2? |
| A: Chinese name of 2219360-82-2 is 2219360-82-2. |
| Q: What is the InChIKey of rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate? |
| A: InChIKey of rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate is AAPZKZIDFCJVDH-ABMFXWLOSA-N. |
| Q: What is the molecular weight of rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate? |
| A: Molecular weight of rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate is 239.31. |
| Q: What is the English name of rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate? |
| A: The English name of rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate is rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate. |
| Q: What is the CAS number of rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate? |
| A: CAS number of rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate is 2219360-82-2. |
| Q: What is the molecular formula of rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate? |
| A: Molecular formula of rac-tert-butyl N-{[(1R,5R,6R)-3-oxatricyclo[3.2.1.0,2,4]octan-6-yl]methyl}carbamate is C13H21NO3. |