1,4-Dimethyl-1,3-dihydro-5-phenyl-2H-imidazol-2-one structure
|
Common Name | 1,4-Dimethyl-1,3-dihydro-5-phenyl-2H-imidazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 22199-48-0 | Molecular Weight | 188.22600 | |
| Density | 1.135g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-dimethyl-4-phenyl-1H-imidazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.135g/cm3 |
|---|---|
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.22600 |
| Exact Mass | 188.09500 |
| PSA | 38.05000 |
| LogP | 2.10110 |
| Index of Refraction | 1.569 |
| InChIKey | DSBAKUBEPYOCFX-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(=O)n(C)c1-c1ccccc1 |
| HS Code | 2933290090 |
|---|
|
~97%
1,4-Dimethyl-1,... CAS#:22199-48-0 |
| Literature: Han, Sunkyu; Siegel, Dustin S.; Movassaghi, Mohammad Tetrahedron Letters, 2012 , vol. 53, # 29 p. 3722 - 3726 |
|
~54%
1,4-Dimethyl-1,... CAS#:22199-48-0 |
| Literature: Butler, Anthony R.; Hussain, Ishtiaq Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1981 , p. 310 - 316 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,4-dimethyl-5-phenyl-1,3-dihydro-imidazol-2-one |
| Gpa-1851 |
| 1,3-Dihydro-1,4-dimethyl-5-phenyl-2H-imidazol-2-one |
| 1,4-Dimethyl-5-phenyl-2-imidazolinone |
| 1,4-dimethyl-5-phenyl-1,3-dihydro-2H-imidazol-2-one |
| 3,4-dimethyl-5-phenyl-4-imidazolin-2-one |