2-[3-(Diphenylmethyl)-5,6-dihydro-1-methyl-1,2,4-triazin-4(1H)-yl]ethanol structure
|
Common Name | 2-[3-(Diphenylmethyl)-5,6-dihydro-1-methyl-1,2,4-triazin-4(1H)-yl]ethanol | ||
|---|---|---|---|---|
| CAS Number | 22201-92-9 | Molecular Weight | 309.40500 | |
| Density | 1.12g/cm3 | Boiling Point | 472.5ºC at 760 mmHg | |
| Molecular Formula | C19H23N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.6ºC | |
| Name | 2-(3-benzhydryl-1-methyl-5,6-dihydro-1,2,4-triazin-4-yl)ethanol |
|---|
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 472.5ºC at 760 mmHg |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.40500 |
| Flash Point | 239.6ºC |
| Exact Mass | 309.18400 |
| PSA | 39.07000 |
| LogP | 1.68310 |
| Vapour Pressure | 9.85E-10mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | RIPSUVKCUGYACN-UHFFFAOYSA-N |
| SMILES | CN1CCN(CCO)C(C(c2ccccc2)c2ccccc2)=N1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |