2-Cyano-N-(4-nitrophenyl)acetamide structure
|
Common Name | 2-Cyano-N-(4-nitrophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 22208-39-5 | Molecular Weight | 205.170 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 501.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H7N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.3±25.9 °C | |
| Name | 2-Cyano-N-(4-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 501.8±35.0 °C at 760 mmHg |
| Molecular Formula | C9H7N3O3 |
| Molecular Weight | 205.170 |
| Flash Point | 257.3±25.9 °C |
| Exact Mass | 205.048737 |
| PSA | 98.71000 |
| LogP | 1.14 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | FIZKBWOSZUORJF-UHFFFAOYSA-N |
| SMILES | N#CCC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2926909090 |
|---|
|
~92%
2-Cyano-N-(4-ni... CAS#:22208-39-5 |
| Literature: TIBOTEC PHARMACEUTICALS LTD. Patent: WO2008/37784 A1, 2008 ; Location in patent: Page/Page column 50 ; |
|
~%
2-Cyano-N-(4-ni... CAS#:22208-39-5 |
| Literature: University of California; Yissum Research Development Company of the Hebrew University of Jerusalem; Biosignal LTD; Sugen, Inc.; Max-Planck-Gesellschaft zur Forderung der Wissenschaften E.V. Patent: US6331555 B1, 2001 ; US 6331555 B1 |
|
~%
2-Cyano-N-(4-ni... CAS#:22208-39-5 |
| Literature: Selvi; Perumal Organic Preparations and Procedures International, 2001 , vol. 33, # 2-3 p. 194 - 198 |
|
~%
2-Cyano-N-(4-ni... CAS#:22208-39-5 |
| Literature: Ried; Schleimer Justus Liebigs Annalen der Chemie, 1959 , vol. 626, p. 106,112 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Cyan-essigsaeure-(4-nitro-anilid) |
| cyano-acetic acid-(4-nitro-anilide) |
| 2-Cyano-N-(4-nitrophenyl)acetamide |
| 2-cyano-4-nitroacetanilide |
| cyano-acetic acid-(3-ethoxy-4-hydroxy-benzylidenehydrazide) |
| Cyan-essigsaeure-(3-aethoxy-4-hydroxy-benzylidenhydrazid) |
| N1-(4-nitrophenyl)-2-cyanoacetamide |
| Cyanoacet-p-nitroanilid |
| 4-Nitro-cyanoacetanilid |
| 2-Cyano-N-(4-nitrophenyl)-acetamide |
| cyanoacetyl-(4-nitro)anilide |