5-benzylidene-3-phenylimidazolidine-2,4-dione structure
|
Common Name | 5-benzylidene-3-phenylimidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 2221-17-2 | Molecular Weight | 264.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-benzylidene-3-phenylimidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12N2O2 |
|---|---|
| Molecular Weight | 264.27900 |
| Exact Mass | 264.09000 |
| PSA | 52.90000 |
| LogP | 2.48890 |
| InChIKey | XDLXSYFCJXJRCR-UHFFFAOYSA-N |
| SMILES | O=C1NC(=Cc2ccccc2)C(=O)N1c1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~%
5-benzylidene-3... CAS#:2221-17-2 |
| Literature: Bergmann; Delis Justus Liebigs Annalen der Chemie, 1927 , vol. 458, p. 83 |
|
~%
5-benzylidene-3... CAS#:2221-17-2 |
| Literature: Kadry, Azza M.; Mansour, Salwa A. Journal of Heterocyclic Chemistry, 1985 , vol. 22, p. 155 - 157 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Benzyliden-3-phenyl-imidazolidin-2,4-dion |
| 1-phenyl-4-benzyliden-hydantoin |
| 5-benzylidene-3-phenyl-imidazolidine-2,4-dione |
| 3-Phenyl-5-benzyliden-hydantoin |
| 5-benzylidene-3-phenylhydantoin |