2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole
Modify Date: 2026-08-23 13:11:09
2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole structure
|
Common Name | 2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole | ||
|---|---|---|---|---|
| CAS Number | 22237-15-6 | Molecular Weight | 224.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13BN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H13BN2O |
|---|---|
| Molecular Weight | 224.07 |
| InChIKey | VRUYHXNDCKQNKX-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)NB(c1ccccc1)N2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole? |
| A: CAS number of 2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole is 22237-15-6. |
| Q: What is the Chinese name of 22237-15-6? |
| A: Chinese name of 22237-15-6 is 22237-15-6. |
| Q: What is the English name of 2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole? |
| A: The English name of 2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole is 2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole. |
| Q: What is the InChIKey of 2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole? |
| A: InChIKey of 2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole is VRUYHXNDCKQNKX-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole? |
| A: SMILES notation of 2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole is COc1ccc2c(c1)NB(c1ccccc1)N2. |
| Q: What is the molecular formula of 2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole? |
| A: Molecular formula of 2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole is C13H13BN2O. |
| Q: What is the molecular weight of 2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole? |
| A: Molecular weight of 2,3-Dihydro-5-methoxy-2-phenyl-1H-1,3,2-benzodiazaborole is 224.07. |